C27H23F2NO3 — CID 59593379
tert-butyl 2-[N-(2,6-difluorobenzoyl)-3-(3-ethynylphenyl)anilino]acetate (PubChem CID 59593379) has the molecular formula C27H23F2NO3 and a molecular weight of 447.48 g/mol. Its IUPAC name is tert-butyl 2-[N-(2,6-difluorobenzoyl)-3-(3-ethynylphenyl)anilino]acetate.
| Compound Name | tert-butyl 2-[N-(2,6-difluorobenzoyl)-3-(3-ethynylphenyl)anilino]acetate |
|---|---|
| PubChem CID | 59593379 |
| Molecular Formula | C27H23F2NO3 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | tert-butyl 2-[N-(2,6-difluorobenzoyl)-3-(3-ethynylphenyl)anilino]acetate |
| SMILES | C#Cc1cccc(-c2cccc(N(CC(=O)OC(C)(C)C)C(=O)c3c(F)cccc3F)c2)c1 |
| InChI | InChI=1S/C27H23F2NO3/c1-5-18-9-6-10-19(15-18)20-11-7-12-21(16-20)30(17-24(31)33-27(2,3)4)26(32)25-22(28)13-8-14-23(25)29/h1,6-16H,17H2,2-4H3 |
| InChIKey | LEFAPJHHASFFCE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|