C32H23EuF3N2O2S — CID 59595484
4,7-diphenyl-1,10-phenanthroline;europium;(Z)-4,4,4-trifluoro-1-thiophen-2-ylbut-1-ene-1,3-diol (PubChem CID 59595484) has the molecular formula C32H23EuF3N2O2S and a molecular weight of 708.57 g/mol. Its IUPAC name is 4,7-diphenyl-1,10-phenanthroline;europium;(Z)-4,4,4-trifluoro-1-thiophen-2-ylbut-1-ene-1,3-diol.
| Compound Name | 4,7-diphenyl-1,10-phenanthroline;europium;(Z)-4,4,4-trifluoro-1-thiophen-2-ylbut-1-ene-1,3-diol |
|---|---|
| PubChem CID | 59595484 |
| Molecular Formula | C32H23EuF3N2O2S |
| Molecular Weight | 708.57 g/mol |
| Exact Mass | 709.06 |
| IUPAC Name | 4,7-diphenyl-1,10-phenanthroline;europium;(Z)-4,4,4-trifluoro-1-thiophen-2-ylbut-1-ene-1,3-diol |
| SMILES | O/C(=C\C(O)C(F)(F)F)c1cccs1.[Eu].c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2.C8H7F3O2S.Eu/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18;9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-16H;1-4,7,12-13H;/b;5-4-; |
| InChIKey | HIEAKGQMOXOHPC-FXHNQCOHSA-N |
| XLogP | 8.69 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.57 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|