About 3-methylbut-2-enyl hydrogen sulfite;yttrium
3-methylbut-2-enyl hydrogen sulfite;yttrium (PubChem CID 59595522) has the molecular formula C5H10O3SY
and a molecular weight of 239.10 g/mol. Its IUPAC name is 3-methylbut-2-enyl hydrogen sulfite;yttrium.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl hydrogen sulfite;yttrium |
| PubChem CID | 59595522 |
| Molecular Formula | C5H10O3SY |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 238.94 |
| IUPAC Name | 3-methylbut-2-enyl hydrogen sulfite;yttrium |
| SMILES | CC(C)=CCOS(=O)O.[Y] |
| InChI | InChI=1S/C5H10O3S.Y/c1-5(2)3-4-8-9(6)7;/h3H,4H2,1-2H3,(H,6,7); |
| InChIKey | QOHONNVBDKMUOW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl hydrogen sulfite;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl hydrogen sulfite;yttrium?
The IUPAC name of 3-methylbut-2-enyl hydrogen sulfite;yttrium (CID 59595522) is 3-methylbut-2-enyl hydrogen sulfite;yttrium.
What is the SMILES notation for 3-methylbut-2-enyl hydrogen sulfite;yttrium?
The canonical SMILES for 3-methylbut-2-enyl hydrogen sulfite;yttrium is CC(C)=CCOS(=O)O.[Y].
What is the InChIKey of 3-methylbut-2-enyl hydrogen sulfite;yttrium?
The InChIKey is QOHONNVBDKMUOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3S.Y/c1-5(2)3-4-8-9(6)7;/h3H,4H2,1-2H3,(H,6,7);.
What are the key properties of 3-methylbut-2-enyl hydrogen sulfite;yttrium?
3-methylbut-2-enyl hydrogen sulfite;yttrium has a molecular weight of 239.10 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl hydrogen sulfite;yttrium is sourced from PubChem (CID 59595522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).