C15H20ClN3O2 — CID 59598775
4-chloro-5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-1,4-dihydropyrimidin-2-amine (PubChem CID 59598775) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 4-chloro-5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-1,4-dihydropyrimidin-2-amine.
| Compound Name | 4-chloro-5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-1,4-dihydropyrimidin-2-amine |
|---|---|
| PubChem CID | 59598775 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 4-chloro-5-(4-methoxy-5-methyl-2-propan-2-ylphenoxy)-1,4-dihydropyrimidin-2-amine |
| SMILES | COc1cc(C(C)C)c(OC2=CNC(N)=NC2Cl)cc1C |
| InChI | InChI=1S/C15H20ClN3O2/c1-8(2)10-6-11(20-4)9(3)5-12(10)21-13-7-18-15(17)19-14(13)16/h5-8,14H,1-4H3,(H3,17,18,19) |
| InChIKey | IASJDWKQGVWZHH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|