C26H32F2N4O — CID 59599078
(2R,3S)-4-(3,5-difluorophenyl)-1-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-[(1-methylpyrazol-4-yl)amino]butan-2-ol (PubChem CID 59599078) has the molecular formula C26H32F2N4O and a molecular weight of 454.57 g/mol. Its IUPAC name is (2R,3S)-4-(3,5-difluorophenyl)-1-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-[(1-methylpyrazol-4-yl)amino]butan-2-ol.
| Compound Name | (2R,3S)-4-(3,5-difluorophenyl)-1-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-[(1-methylpyrazol-4-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 59599078 |
| Molecular Formula | C26H32F2N4O |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (2R,3S)-4-(3,5-difluorophenyl)-1-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-[(1-methylpyrazol-4-yl)amino]butan-2-ol |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)Nc1cnn(C)c1)CCC2 |
| InChI | InChI=1S/C26H32F2N4O/c1-3-17-7-8-19-5-4-6-24(23(19)11-17)29-15-26(33)25(31-22-14-30-32(2)16-22)12-18-9-20(27)13-21(28)10-18/h7-11,13-14,16,24-26,29,31,33H,3-6,12,15H2,1-2H3/t24-,25-,26+/m0/s1 |
| InChIKey | CUDHSLWAVDPOBM-KKUQBAQOSA-N |
| XLogP | 4.31 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |