C23H21NO6S — CID 59599604
5-[3-[(4-acetyl-2-ethyl-3-hydroxyphenoxy)methyl]phenyl]sulfinylpyridine-3-carboxylic acid (PubChem CID 59599604) has the molecular formula C23H21NO6S and a molecular weight of 439.49 g/mol. Its IUPAC name is 5-[3-[(4-acetyl-2-ethyl-3-hydroxyphenoxy)methyl]phenyl]sulfinylpyridine-3-carboxylic acid.
| Compound Name | 5-[3-[(4-acetyl-2-ethyl-3-hydroxyphenoxy)methyl]phenyl]sulfinylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 59599604 |
| Molecular Formula | C23H21NO6S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 5-[3-[(4-acetyl-2-ethyl-3-hydroxyphenoxy)methyl]phenyl]sulfinylpyridine-3-carboxylic acid |
| SMILES | CCc1c(OCc2cccc(S(=O)c3cncc(C(=O)O)c3)c2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C23H21NO6S/c1-3-19-21(8-7-20(14(2)25)22(19)26)30-13-15-5-4-6-17(9-15)31(29)18-10-16(23(27)28)11-24-12-18/h4-12,26H,3,13H2,1-2H3,(H,27,28) |
| InChIKey | BVBZSVOYHYXLPX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |