C24H25NO4S — CID 89089177
1-[4-[[3-(2-aminophenyl)sulfinylphenyl]methoxy]-2-hydroxy-3-propylphenyl]ethanone (PubChem CID 89089177) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 1-[4-[[3-(2-aminophenyl)sulfinylphenyl]methoxy]-2-hydroxy-3-propylphenyl]ethanone.
| Compound Name | 1-[4-[[3-(2-aminophenyl)sulfinylphenyl]methoxy]-2-hydroxy-3-propylphenyl]ethanone |
|---|---|
| PubChem CID | 89089177 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-[4-[[3-(2-aminophenyl)sulfinylphenyl]methoxy]-2-hydroxy-3-propylphenyl]ethanone |
| SMILES | CCCc1c(OCc2cccc(S(=O)c3ccccc3N)c2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C24H25NO4S/c1-3-7-20-22(13-12-19(16(2)26)24(20)27)29-15-17-8-6-9-18(14-17)30(28)23-11-5-4-10-21(23)25/h4-6,8-14,27H,3,7,15,25H2,1-2H3 |
| InChIKey | RKSCDCLOIGVYMW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|