C25H36N4O4 — CID 59600017
2-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]cyclohexanecarbonyl]amino]cyclohexane-1-carboxamide (PubChem CID 59600017) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]cyclohexanecarbonyl]amino]cyclohexane-1-carboxamide.
| Compound Name | 2-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]cyclohexanecarbonyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59600017 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 2-[[2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]cyclohexanecarbonyl]amino]cyclohexane-1-carboxamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)NC1CCCCC1C(=O)NC1CCCCC1C(N)=O |
| InChI | InChI=1S/C25H36N4O4/c1-16(30)27-22(15-17-9-3-2-4-10-17)25(33)29-21-14-8-6-12-19(21)24(32)28-20-13-7-5-11-18(20)23(26)31/h2-4,9-10,18-22H,5-8,11-15H2,1H3,(H2,26,31)(H,27,30)(H,28,32)(H,29,33)/t18?,19?,20?,21?,22-/m0/s1 |
| InChIKey | NXCLKPFIJBPGHL-BLJKDTPWSA-N |
| XLogP | 1.57 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |