C16H28N3O3Y- — CID 59601438
[(2S)-1-[2-[[(2R)-4-hydroxypent-4-en-2-yl]carbamoyl]piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]azanide;yttrium (PubChem CID 59601438) has the molecular formula C16H28N3O3Y- and a molecular weight of 399.32 g/mol. Its IUPAC name is [(2S)-1-[2-[[(2R)-4-hydroxypent-4-en-2-yl]carbamoyl]piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]azanide;yttrium.
| Compound Name | [(2S)-1-[2-[[(2R)-4-hydroxypent-4-en-2-yl]carbamoyl]piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]azanide;yttrium |
|---|---|
| PubChem CID | 59601438 |
| Molecular Formula | C16H28N3O3Y- |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [(2S)-1-[2-[[(2R)-4-hydroxypent-4-en-2-yl]carbamoyl]piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]azanide;yttrium |
| SMILES | C=C(O)C[C@@H](C)NC(=O)C1CCCCN1C(=O)[C@@H]([NH-])C(C)C.[Y] |
| InChI | InChI=1S/C16H28N3O3.Y/c1-10(2)14(17)16(22)19-8-6-5-7-13(19)15(21)18-11(3)9-12(4)20;/h10-11,13-14,17,20H,4-9H2,1-3H3,(H,18,21);/q-1;/t11-,13?,14+;/m1./s1 |
| InChIKey | DUIUOPPWPWYZKJ-WEVUIEQMSA-N |
| XLogP | 2.41 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|