C19H21F2O6S- — CID 59602111
[3-(4-hydroxyphenyl)-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 59602111) has the molecular formula C19H21F2O6S- and a molecular weight of 415.43 g/mol. Its IUPAC name is [3-(4-hydroxyphenyl)-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | [3-(4-hydroxyphenyl)-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 59602111 |
| Molecular Formula | C19H21F2O6S- |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [3-(4-hydroxyphenyl)-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | O=C(OCC12CC3CC(C1)CC(c1ccc(O)cc1)(C3)C2)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C19H22F2O6S/c20-19(21,28-27-26-24)16(23)25-11-17-6-12-5-13(7-17)9-18(8-12,10-17)14-1-3-15(22)4-2-14/h1-4,12-13,22,24H,5-11H2/p-1 |
| InChIKey | HJQUBQXLYGBRNO-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|