C32H32F2O5S — CID 59360519
[2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] adamantane-1-carboxylate (PubChem CID 59360519) has the molecular formula C32H32F2O5S and a molecular weight of 566.67 g/mol. Its IUPAC name is [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] adamantane-1-carboxylate.
| Compound Name | [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 59360519 |
| Molecular Formula | C32H32F2O5S |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] adamantane-1-carboxylate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)C(c1ccccc1)(c1ccccc1)c1ccc(O)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H32F2O5S/c33-31(34,21-39-29(36)30-18-22-15-23(19-30)17-24(16-22)20-30)40(37,38)32(25-7-3-1-4-8-25,26-9-5-2-6-10-26)27-11-13-28(35)14-12-27/h1-14,22-24,35H,15-21H2 |
| InChIKey | XBKXTRKSMCWNPI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|