About [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate
[2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate (PubChem CID 59360511) has the molecular formula C24H22F2O5S
and a molecular weight of 460.50 g/mol. Its IUPAC name is [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate.
Molecular Properties
| Compound Name | [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate |
| PubChem CID | 59360511 |
| Molecular Formula | C24H22F2O5S |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate |
| SMILES | CCC(=O)OCC(F)(F)S(=O)(=O)C(c1ccccc1)(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H22F2O5S/c1-2-22(28)31-17-23(25,26)32(29,30)24(18-9-5-3-6-10-18,19-11-7-4-8-12-19)20-13-15-21(27)16-14-20/h3-16,27H,2,17H2,1H3 |
| InChIKey | YVYNZAWIFZYKTB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate?
The IUPAC name of [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate (CID 59360511) is [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate.
What is the SMILES notation for [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate?
The canonical SMILES for [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate is CCC(=O)OCC(F)(F)S(=O)(=O)C(c1ccccc1)(c1ccccc1)c1ccc(O)cc1.
What is the InChIKey of [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate?
The InChIKey is YVYNZAWIFZYKTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22F2O5S/c1-2-22(28)31-17-23(25,26)32(29,30)24(18-9-5-3-6-10-18,19-11-7-4-8-12-19)20-13-15-21(27)16-14-20/h3-16,27H,2,17H2,1H3.
What are the key properties of [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate?
[2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate has a molecular weight of 460.50 g/mol, XLogP of 4.64, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate is sourced from PubChem (CID 59360511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).