C24H22F2O5S — CID 59360511
[2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate (PubChem CID 59360511) has the molecular formula C24H22F2O5S and a molecular weight of 460.50 g/mol. Its IUPAC name is [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate.
| Compound Name | [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate |
|---|---|
| PubChem CID | 59360511 |
| Molecular Formula | C24H22F2O5S |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [2,2-difluoro-2-[(4-hydroxyphenyl)-diphenylmethyl]sulfonylethyl] propanoate |
| SMILES | CCC(=O)OCC(F)(F)S(=O)(=O)C(c1ccccc1)(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H22F2O5S/c1-2-22(28)31-17-23(25,26)32(29,30)24(18-9-5-3-6-10-18,19-11-7-4-8-12-19)20-13-15-21(27)16-14-20/h3-16,27H,2,17H2,1H3 |
| InChIKey | YVYNZAWIFZYKTB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|