C31H33F2O6S2+ — CID 87529619
2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonic acid;(4-hydroxyphenyl)-diphenylsulfanium (PubChem CID 87529619) has the molecular formula C31H33F2O6S2+ and a molecular weight of 603.73 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonic acid;(4-hydroxyphenyl)-diphenylsulfanium.
| Compound Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonic acid;(4-hydroxyphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 87529619 |
| Molecular Formula | C31H33F2O6S2+ |
| Molecular Weight | 603.73 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonic acid;(4-hydroxyphenyl)-diphenylsulfanium |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C12CC3CC(CC(C3)C1)C2.Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H14OS.C13H18F2O5S/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;14-13(15,21(17,18)19)7-20-11(16)12-4-8-1-9(5-12)3-10(2-8)6-12/h1-14H;8-10H,1-7H2,(H,17,18,19)/p+1 |
| InChIKey | VDIUUKOCGCAKDJ-UHFFFAOYSA-O |
| XLogP | 6.71 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.73 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|