C52H58F3O9S2+ — CID 57004424
trifluoromethylsulfonyl-[tris[4-(adamantane-1-carbonyloxy)phenyl]-λ4-sulfanyl]oxidanium (PubChem CID 57004424) has the molecular formula C52H58F3O9S2+ and a molecular weight of 948.15 g/mol. Its IUPAC name is trifluoromethylsulfonyl-[tris[4-(adamantane-1-carbonyloxy)phenyl]-λ4-sulfanyl]oxidanium.
| Compound Name | trifluoromethylsulfonyl-[tris[4-(adamantane-1-carbonyloxy)phenyl]-λ4-sulfanyl]oxidanium |
|---|---|
| PubChem CID | 57004424 |
| Molecular Formula | C52H58F3O9S2+ |
| Molecular Weight | 948.15 g/mol |
| Exact Mass | 947.35 |
| IUPAC Name | trifluoromethylsulfonyl-[tris[4-(adamantane-1-carbonyloxy)phenyl]-λ4-sulfanyl]oxidanium |
| SMILES | O=C(Oc1ccc(S([OH+]S(=O)(=O)C(F)(F)F)(c2ccc(OC(=O)C34CC5CC(CC(C5)C3)C4)cc2)c2ccc(OC(=O)C34CC5CC(CC(C5)C3)C4)cc2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C52H57F3O9S2/c53-52(54,55)66(59,60)64-65(43-7-1-40(2-8-43)61-46(56)49-22-31-13-32(23-49)15-33(14-31)24-49,44-9-3-41(4-10-44)62-47(57)50-25-34-16-35(26-50)18-36(17-34)27-50)45-11-5-42(6-12-45)63-48(58)51-28-37-19-38(29-51)21-39(20-37)30-51/h1-12,31-39H,13-30H2/p+1 |
| InChIKey | MKQQNGOWNFHHOP-UHFFFAOYSA-O |
| XLogP | 12.19 |
| TPSA | 125.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.15 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|