C19H22F2O6S — CID 88971573
1,1-difluoro-2-[[3-(4-hydroxyphenyl)-1-adamantyl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 88971573) has the molecular formula C19H22F2O6S and a molecular weight of 416.44 g/mol. Its IUPAC name is 1,1-difluoro-2-[[3-(4-hydroxyphenyl)-1-adamantyl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[3-(4-hydroxyphenyl)-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88971573 |
| Molecular Formula | C19H22F2O6S |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1,1-difluoro-2-[[3-(4-hydroxyphenyl)-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(OCC12CC3CC(C1)CC(c1ccc(O)cc1)(C3)C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C19H22F2O6S/c20-19(21,28(24,25)26)16(23)27-11-17-6-12-5-13(7-17)9-18(8-12,10-17)14-1-3-15(22)4-2-14/h1-4,12-13,22H,5-11H2,(H,24,25,26) |
| InChIKey | YMTKLHPSSTUHDJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|