C9H19NO2 — CID 59602998
4-(2-ethyl-1,3-dioxolan-2-yl)butan-1-amine (PubChem CID 59602998) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-(2-ethyl-1,3-dioxolan-2-yl)butan-1-amine.
| Compound Name | 4-(2-ethyl-1,3-dioxolan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 59602998 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 4-(2-ethyl-1,3-dioxolan-2-yl)butan-1-amine |
| SMILES | CCC1(CCCCN)OCCO1 |
| InChI | InChI=1S/C9H19NO2/c1-2-9(5-3-4-6-10)11-7-8-12-9/h2-8,10H2,1H3 |
| InChIKey | ASPQRMZFMDAOTB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|