C7H9Cl3 — CID 596036
1,2,2-trichloroethenylcyclopentane (PubChem CID 596036) has the molecular formula C7H9Cl3 and a molecular weight of 199.51 g/mol. Its IUPAC name is 1,2,2-trichloroethenylcyclopentane.
| Compound Name | 1,2,2-trichloroethenylcyclopentane |
|---|---|
| PubChem CID | 596036 |
| Molecular Formula | C7H9Cl3 |
| Molecular Weight | 199.51 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 1,2,2-trichloroethenylcyclopentane |
| SMILES | ClC(Cl)=C(Cl)C1CCCC1 |
| InChI | InChI=1S/C7H9Cl3/c8-6(7(9)10)5-3-1-2-4-5/h5H,1-4H2 |
| InChIKey | NXMNYMTYXKDGLA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |