C25H28N10O — CID 59605483
N-[[9-methyl-2-(2-methylbenzimidazol-1-yl)-6-morpholin-4-ylpurin-8-yl]methyl]-2-pyrazin-2-ylethanamine (PubChem CID 59605483) has the molecular formula C25H28N10O and a molecular weight of 484.57 g/mol. Its IUPAC name is N-[[9-methyl-2-(2-methylbenzimidazol-1-yl)-6-morpholin-4-ylpurin-8-yl]methyl]-2-pyrazin-2-ylethanamine.
| Compound Name | N-[[9-methyl-2-(2-methylbenzimidazol-1-yl)-6-morpholin-4-ylpurin-8-yl]methyl]-2-pyrazin-2-ylethanamine |
|---|---|
| PubChem CID | 59605483 |
| Molecular Formula | C25H28N10O |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[[9-methyl-2-(2-methylbenzimidazol-1-yl)-6-morpholin-4-ylpurin-8-yl]methyl]-2-pyrazin-2-ylethanamine |
| SMILES | Cc1nc2ccccc2n1-c1nc(N2CCOCC2)c2nc(CNCCc3cnccn3)n(C)c2n1 |
| InChI | InChI=1S/C25H28N10O/c1-17-29-19-5-3-4-6-20(19)35(17)25-31-23-22(24(32-25)34-11-13-36-14-12-34)30-21(33(23)2)16-26-8-7-18-15-27-9-10-28-18/h3-6,9-10,15,26H,7-8,11-14,16H2,1-2H3 |
| InChIKey | UUDJMBLLAZPNSM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|