C25H29N9O3 — CID 59605713
4-[2-(2-ethylbenzimidazol-1-yl)-9-methyl-6-morpholin-4-ylpurine-8-carbonyl]piperazine-1-carbaldehyde (PubChem CID 59605713) has the molecular formula C25H29N9O3 and a molecular weight of 503.57 g/mol. Its IUPAC name is 4-[2-(2-ethylbenzimidazol-1-yl)-9-methyl-6-morpholin-4-ylpurine-8-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(2-ethylbenzimidazol-1-yl)-9-methyl-6-morpholin-4-ylpurine-8-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 59605713 |
| Molecular Formula | C25H29N9O3 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 4-[2-(2-ethylbenzimidazol-1-yl)-9-methyl-6-morpholin-4-ylpurine-8-carbonyl]piperazine-1-carbaldehyde |
| SMILES | CCc1nc2ccccc2n1-c1nc(N2CCOCC2)c2nc(C(=O)N3CCN(C=O)CC3)n(C)c2n1 |
| InChI | InChI=1S/C25H29N9O3/c1-3-19-26-17-6-4-5-7-18(17)34(19)25-28-21-20(22(29-25)32-12-14-37-15-13-32)27-23(30(21)2)24(36)33-10-8-31(16-35)9-11-33/h4-7,16H,3,8-15H2,1-2H3 |
| InChIKey | LXIFOJKIEFTHGR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 114.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|