C25H31ClN2O6S — CID 59607864
butyl 4-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-(methanesulfonamido)-4-oxobutan-2-yl]amino]-4-oxobutanoate (PubChem CID 59607864) has the molecular formula C25H31ClN2O6S and a molecular weight of 523.05 g/mol. Its IUPAC name is butyl 4-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-(methanesulfonamido)-4-oxobutan-2-yl]amino]-4-oxobutanoate.
| Compound Name | butyl 4-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-(methanesulfonamido)-4-oxobutan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 59607864 |
| Molecular Formula | C25H31ClN2O6S |
| Molecular Weight | 523.05 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | butyl 4-[[(2R)-1-[4-(3-chlorophenyl)phenyl]-4-(methanesulfonamido)-4-oxobutan-2-yl]amino]-4-oxobutanoate |
| SMILES | CCCCOC(=O)CCC(=O)N[C@@H](CC(=O)NS(C)(=O)=O)Cc1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C25H31ClN2O6S/c1-3-4-14-34-25(31)13-12-23(29)27-22(17-24(30)28-35(2,32)33)15-18-8-10-19(11-9-18)20-6-5-7-21(26)16-20/h5-11,16,22H,3-4,12-15,17H2,1-2H3,(H,27,29)(H,28,30)/t22-/m1/s1 |
| InChIKey | UTBYRQFNENAMNX-JOCHJYFZSA-N |
| XLogP | 3.62 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.05 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|