C22H23ClN2O4 — CID 91321600
ethyl (3R)-4-[4-(3-chlorophenyl)phenyl]-3-[(4-imino-2-oxobutanoyl)amino]butanoate (PubChem CID 91321600) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is ethyl (3R)-4-[4-(3-chlorophenyl)phenyl]-3-[(4-imino-2-oxobutanoyl)amino]butanoate.
| Compound Name | ethyl (3R)-4-[4-(3-chlorophenyl)phenyl]-3-[(4-imino-2-oxobutanoyl)amino]butanoate |
|---|---|
| PubChem CID | 91321600 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | ethyl (3R)-4-[4-(3-chlorophenyl)phenyl]-3-[(4-imino-2-oxobutanoyl)amino]butanoate |
| SMILES | [H]/N=C/CC(=O)C(=O)N[C@@H](CC(=O)OCC)Cc1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H23ClN2O4/c1-2-29-21(27)14-19(25-22(28)20(26)10-11-24)12-15-6-8-16(9-7-15)17-4-3-5-18(23)13-17/h3-9,11,13,19,24H,2,10,12,14H2,1H3,(H,25,28)/b24-11+/t19-/m1/s1 |
| InChIKey | PTUBMLWLGYYKRG-CCYMUMOUSA-N |
| XLogP | 3.60 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|