C27H30N5O3+ — CID 137047495
[[1-amino-2-[[(2R)-4-ethoxy-4-oxo-1-(4-phenylphenyl)butan-2-yl]amino]-2-oxoethylidene]amino]-benzyl-iminoazanium (PubChem CID 137047495) has the molecular formula C27H30N5O3+ and a molecular weight of 472.57 g/mol. Its IUPAC name is [[1-amino-2-[[(2R)-4-ethoxy-4-oxo-1-(4-phenylphenyl)butan-2-yl]amino]-2-oxoethylidene]amino]-benzyl-iminoazanium.
| Compound Name | [[1-amino-2-[[(2R)-4-ethoxy-4-oxo-1-(4-phenylphenyl)butan-2-yl]amino]-2-oxoethylidene]amino]-benzyl-iminoazanium |
|---|---|
| PubChem CID | 137047495 |
| Molecular Formula | C27H30N5O3+ |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | [[1-amino-2-[[(2R)-4-ethoxy-4-oxo-1-(4-phenylphenyl)butan-2-yl]amino]-2-oxoethylidene]amino]-benzyl-iminoazanium |
| SMILES | [H]/N=[N+](\Cc1ccccc1)N=C(N)C(=O)N[C@@H](CC(=O)OCC)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N5O3/c1-2-35-25(33)18-24(17-20-13-15-23(16-14-20)22-11-7-4-8-12-22)30-27(34)26(28)31-32(29)19-21-9-5-3-6-10-21/h3-16,24H,2,17-19H2,1H3,(H3-,28,29,30,31,34)/p+1/t24-/m1/s1 |
| InChIKey | BANZLTTUJPUIHS-XMMPIXPASA-O |
| XLogP | 3.85 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|