C25H32NO9P — CID 67726328
3-[(1,5-diethoxy-1,5-dioxo-3-phosphonopentan-3-yl)amino]-4-(4-phenylphenyl)butanoic acid (PubChem CID 67726328) has the molecular formula C25H32NO9P and a molecular weight of 521.50 g/mol. Its IUPAC name is 3-[(1,5-diethoxy-1,5-dioxo-3-phosphonopentan-3-yl)amino]-4-(4-phenylphenyl)butanoic acid.
| Compound Name | 3-[(1,5-diethoxy-1,5-dioxo-3-phosphonopentan-3-yl)amino]-4-(4-phenylphenyl)butanoic acid |
|---|---|
| PubChem CID | 67726328 |
| Molecular Formula | C25H32NO9P |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 3-[(1,5-diethoxy-1,5-dioxo-3-phosphonopentan-3-yl)amino]-4-(4-phenylphenyl)butanoic acid |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(NC(CC(=O)O)Cc1ccc(-c2ccccc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C25H32NO9P/c1-3-34-23(29)16-25(36(31,32)33,17-24(30)35-4-2)26-21(15-22(27)28)14-18-10-12-20(13-11-18)19-8-6-5-7-9-19/h5-13,21,26H,3-4,14-17H2,1-2H3,(H,27,28)(H2,31,32,33) |
| InChIKey | YEMKWCCSOSMNLY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|