C26H25N5O4 — CID 59612987
8-[6-(dimethoxymethyl)-5-methoxy-3-pyridinyl]-3-methyl-1-(2-methyl-3-pyridinyl)imidazo[4,5-c]quinolin-2-one (PubChem CID 59612987) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 8-[6-(dimethoxymethyl)-5-methoxy-3-pyridinyl]-3-methyl-1-(2-methyl-3-pyridinyl)imidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-[6-(dimethoxymethyl)-5-methoxy-3-pyridinyl]-3-methyl-1-(2-methyl-3-pyridinyl)imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 59612987 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 8-[6-(dimethoxymethyl)-5-methoxy-3-pyridinyl]-3-methyl-1-(2-methyl-3-pyridinyl)imidazo[4,5-c]quinolin-2-one |
| SMILES | COc1cc(-c2ccc3ncc4c(c3c2)n(-c2cccnc2C)c(=O)n4C)cnc1C(OC)OC |
| InChI | InChI=1S/C26H25N5O4/c1-15-20(7-6-10-27-15)31-24-18-11-16(8-9-19(18)28-14-21(24)30(2)26(31)32)17-12-22(33-3)23(29-13-17)25(34-4)35-5/h6-14,25H,1-5H3 |
| InChIKey | AFFVWVJRJQSXCG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|