C26H30N8O3 — CID 59613395
tert-butyl 3-[[[5-(3-formylpyrrol-1-yl)-2-[(5-isocyanopyrazin-2-yl)amino]-4-pyridinyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 59613395) has the molecular formula C26H30N8O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is tert-butyl 3-[[[5-(3-formylpyrrol-1-yl)-2-[(5-isocyanopyrazin-2-yl)amino]-4-pyridinyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[5-(3-formylpyrrol-1-yl)-2-[(5-isocyanopyrazin-2-yl)amino]-4-pyridinyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59613395 |
| Molecular Formula | C26H30N8O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | tert-butyl 3-[[[5-(3-formylpyrrol-1-yl)-2-[(5-isocyanopyrazin-2-yl)amino]-4-pyridinyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(NCC3CCCN(C(=O)OC(C)(C)C)C3)c(-n3ccc(C=O)c3)cn2)cn1 |
| InChI | InChI=1S/C26H30N8O3/c1-26(2,3)37-25(36)34-8-5-6-18(15-34)11-28-20-10-22(32-24-14-30-23(27-4)13-31-24)29-12-21(20)33-9-7-19(16-33)17-35/h7,9-10,12-14,16-18H,5-6,8,11,15H2,1-3H3,(H2,28,29,31,32) |
| InChIKey | ZVPNJBGRBOWGMO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|