C35H42N7O4+ — CID 59616377
4-[[4-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylic acid (PubChem CID 59616377) has the molecular formula C35H42N7O4+ and a molecular weight of 624.77 g/mol. Its IUPAC name is 4-[[4-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[[4-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 59616377 |
| Molecular Formula | C35H42N7O4+ |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | 4-[[4-[6-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]hexanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylic acid |
| SMILES | CN(C)c1ccc2cc3ccc(N(C)C)cc3[n+](CCCCCC(=O)Nc3cc(C(=O)Nc4cc(C(=O)O)n(C)c4)n(C)c3)c2c1 |
| InChI | InChI=1S/C35H41N7O4/c1-38(2)27-13-11-23-16-24-12-14-28(39(3)4)20-30(24)42(29(23)19-27)15-9-7-8-10-33(43)36-25-17-31(40(5)21-25)34(44)37-26-18-32(35(45)46)41(6)22-26/h11-14,16-22H,7-10,15H2,1-6H3,(H2-,36,37,43,44,45,46)/p+1 |
| InChIKey | ICGZBLFUGPFEBZ-UHFFFAOYSA-O |
| XLogP | 5.24 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|