C20H16Cl2N4O2 — CID 59618071
N-[2-(benzylcarbamoylamino)-4-pyridinyl]-2,6-dichlorobenzamide (PubChem CID 59618071) has the molecular formula C20H16Cl2N4O2 and a molecular weight of 415.28 g/mol. Its IUPAC name is N-[2-(benzylcarbamoylamino)-4-pyridinyl]-2,6-dichlorobenzamide.
| Compound Name | N-[2-(benzylcarbamoylamino)-4-pyridinyl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 59618071 |
| Molecular Formula | C20H16Cl2N4O2 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[2-(benzylcarbamoylamino)-4-pyridinyl]-2,6-dichlorobenzamide |
| SMILES | O=C(NCc1ccccc1)Nc1cc(NC(=O)c2c(Cl)cccc2Cl)ccn1 |
| InChI | InChI=1S/C20H16Cl2N4O2/c21-15-7-4-8-16(22)18(15)19(27)25-14-9-10-23-17(11-14)26-20(28)24-12-13-5-2-1-3-6-13/h1-11H,12H2,(H3,23,24,25,26,27,28) |
| InChIKey | QSCWEIYEKCBTFN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |