C15H10Cl2N4O2 — CID 59618360
2,6-dichloro-N-[2-[(2-cyanoacetyl)amino]-4-pyridinyl]benzamide (PubChem CID 59618360) has the molecular formula C15H10Cl2N4O2 and a molecular weight of 349.18 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-[(2-cyanoacetyl)amino]-4-pyridinyl]benzamide.
| Compound Name | 2,6-dichloro-N-[2-[(2-cyanoacetyl)amino]-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 59618360 |
| Molecular Formula | C15H10Cl2N4O2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2,6-dichloro-N-[2-[(2-cyanoacetyl)amino]-4-pyridinyl]benzamide |
| SMILES | N#CCC(=O)Nc1cc(NC(=O)c2c(Cl)cccc2Cl)ccn1 |
| InChI | InChI=1S/C15H10Cl2N4O2/c16-10-2-1-3-11(17)14(10)15(23)20-9-5-7-19-12(8-9)21-13(22)4-6-18/h1-3,5,7-8H,4H2,(H2,19,20,21,22,23) |
| InChIKey | LLSJCQRPCBWODB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |