C12H7ClF2N2O — CID 59618586
2-chloro-3,6-difluoro-N-pyridin-4-ylbenzamide (PubChem CID 59618586) has the molecular formula C12H7ClF2N2O and a molecular weight of 268.65 g/mol. Its IUPAC name is 2-chloro-3,6-difluoro-N-pyridin-4-ylbenzamide.
| Compound Name | 2-chloro-3,6-difluoro-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 59618586 |
| Molecular Formula | C12H7ClF2N2O |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-chloro-3,6-difluoro-N-pyridin-4-ylbenzamide |
| SMILES | O=C(Nc1ccncc1)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C12H7ClF2N2O/c13-11-9(15)2-1-8(14)10(11)12(18)17-7-3-5-16-6-4-7/h1-6H,(H,16,17,18) |
| InChIKey | BPNINJAZZUXGRJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|