C16H12ClF2N3O2 — CID 59617959
2-chloro-N-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-3,6-difluorobenzamide (PubChem CID 59617959) has the molecular formula C16H12ClF2N3O2 and a molecular weight of 351.74 g/mol. Its IUPAC name is 2-chloro-N-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-3,6-difluorobenzamide.
| Compound Name | 2-chloro-N-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-3,6-difluorobenzamide |
|---|---|
| PubChem CID | 59617959 |
| Molecular Formula | C16H12ClF2N3O2 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-chloro-N-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-3,6-difluorobenzamide |
| SMILES | O=C(Nc1ccnc(NC(=O)C2CC2)c1)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C16H12ClF2N3O2/c17-14-11(19)4-3-10(18)13(14)16(24)21-9-5-6-20-12(7-9)22-15(23)8-1-2-8/h3-8H,1-2H2,(H2,20,21,22,23,24) |
| InChIKey | IOFHSIJVVMMDAT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|