C27H15Br2N — CID 59622204
3-[3-(3,5-dibromophenyl)phenyl]-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene (PubChem CID 59622204) has the molecular formula C27H15Br2N and a molecular weight of 513.23 g/mol. Its IUPAC name is 3-[3-(3,5-dibromophenyl)phenyl]-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene.
| Compound Name | 3-[3-(3,5-dibromophenyl)phenyl]-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene |
|---|---|
| PubChem CID | 59622204 |
| Molecular Formula | C27H15Br2N |
| Molecular Weight | 513.23 g/mol |
| Exact Mass | 510.96 |
| IUPAC Name | 3-[3-(3,5-dibromophenyl)phenyl]-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene |
| SMILES | Brc1cc(Br)cc(-c2cccc(-c3cc4c5c(cccc5n3)-c3ccccc3-4)c2)c1 |
| InChI | InChI=1S/C27H15Br2N/c28-19-12-18(13-20(29)14-19)16-5-3-6-17(11-16)26-15-24-22-8-2-1-7-21(22)23-9-4-10-25(30-26)27(23)24/h1-15H |
| InChIKey | NCAWWBKEKHRMDW-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.23 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |