C25H21ClF3N3O3 — CID 59623719
1-[1-(6-chloro-3-pyridinyl)-3-methylbutyl]-4-oxo-3-[3-(trifluoromethoxy)phenyl]pyrido[1,2-a]pyrimidin-1-ium-2-olate (PubChem CID 59623719) has the molecular formula C25H21ClF3N3O3 and a molecular weight of 503.91 g/mol. Its IUPAC name is 1-[1-(6-chloro-3-pyridinyl)-3-methylbutyl]-4-oxo-3-[3-(trifluoromethoxy)phenyl]pyrido[1,2-a]pyrimidin-1-ium-2-olate.
| Compound Name | 1-[1-(6-chloro-3-pyridinyl)-3-methylbutyl]-4-oxo-3-[3-(trifluoromethoxy)phenyl]pyrido[1,2-a]pyrimidin-1-ium-2-olate |
|---|---|
| PubChem CID | 59623719 |
| Molecular Formula | C25H21ClF3N3O3 |
| Molecular Weight | 503.91 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 1-[1-(6-chloro-3-pyridinyl)-3-methylbutyl]-4-oxo-3-[3-(trifluoromethoxy)phenyl]pyrido[1,2-a]pyrimidin-1-ium-2-olate |
| SMILES | CC(C)CC(c1ccc(Cl)nc1)[n+]1c([O-])c(-c2cccc(OC(F)(F)F)c2)c(=O)n2ccccc21 |
| InChI | InChI=1S/C25H21ClF3N3O3/c1-15(2)12-19(17-9-10-20(26)30-14-17)32-21-8-3-4-11-31(21)23(33)22(24(32)34)16-6-5-7-18(13-16)35-25(27,28)29/h3-11,13-15,19H,12H2,1-2H3 |
| InChIKey | UWXKNFBPACUBNC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|