C21H16ClN3O3 — CID 162514968
1-[(6-chloro-3-pyridinyl)methyl]-3-(3-methylphenoxy)carbonylimidazo[1,2-a]pyridin-1-ium-2-olate (PubChem CID 162514968) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3-(3-methylphenoxy)carbonylimidazo[1,2-a]pyridin-1-ium-2-olate.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-(3-methylphenoxy)carbonylimidazo[1,2-a]pyridin-1-ium-2-olate |
|---|---|
| PubChem CID | 162514968 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-(3-methylphenoxy)carbonylimidazo[1,2-a]pyridin-1-ium-2-olate |
| SMILES | Cc1cccc(OC(=O)c2c([O-])[n+](Cc3ccc(Cl)nc3)c3ccccn23)c1 |
| InChI | InChI=1S/C21H16ClN3O3/c1-14-5-4-6-16(11-14)28-21(27)19-20(26)25(18-7-2-3-10-24(18)19)13-15-8-9-17(22)23-12-15/h2-12H,13H2,1H3 |
| InChIKey | DGQBONLOIVUFSZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|