C25H25ClN5O4S+ — CID 169094570
3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 169094570) has the molecular formula C25H25ClN5O4S+ and a molecular weight of 527.03 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 169094570 |
| Molecular Formula | C25H25ClN5O4S+ |
| Molecular Weight | 527.03 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | O=c1c(CN2CCN(S(=O)(=O)c3ccccc3)CC2)c(O)[n+](Cc2ccc(Cl)nc2)c2ccccn12 |
| InChI | InChI=1S/C25H24ClN5O4S/c26-22-10-9-19(16-27-22)17-31-23-8-4-5-11-30(23)24(32)21(25(31)33)18-28-12-14-29(15-13-28)36(34,35)20-6-2-1-3-7-20/h1-11,16H,12-15,17-18H2/p+1 |
| InChIKey | DXULBEONBDNEPL-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.03 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|