C22H26N5O6S+ — CID 169094595
2-hydroxy-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1-propylpyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 169094595) has the molecular formula C22H26N5O6S+ and a molecular weight of 488.55 g/mol. Its IUPAC name is 2-hydroxy-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1-propylpyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 2-hydroxy-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1-propylpyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 169094595 |
| Molecular Formula | C22H26N5O6S+ |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-hydroxy-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-1-propylpyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | CCC[n+]1c(O)c(CN2CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC2)c(=O)n2ccccc21 |
| InChI | InChI=1S/C22H25N5O6S/c1-2-10-25-20-5-3-4-11-26(20)22(29)19(21(25)28)16-23-12-14-24(15-13-23)34(32,33)18-8-6-17(7-9-18)27(30)31/h3-9,11H,2,10,12-16H2,1H3/p+1 |
| InChIKey | YNWOSERFJAHRFB-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|