C20H16N4O3 — CID 162515062
3-(3-methylphenoxy)carbonyl-1-(pyrimidin-5-ylmethyl)imidazo[1,2-a]pyridin-1-ium-2-olate (PubChem CID 162515062) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-(3-methylphenoxy)carbonyl-1-(pyrimidin-5-ylmethyl)imidazo[1,2-a]pyridin-1-ium-2-olate.
| Compound Name | 3-(3-methylphenoxy)carbonyl-1-(pyrimidin-5-ylmethyl)imidazo[1,2-a]pyridin-1-ium-2-olate |
|---|---|
| PubChem CID | 162515062 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3-(3-methylphenoxy)carbonyl-1-(pyrimidin-5-ylmethyl)imidazo[1,2-a]pyridin-1-ium-2-olate |
| SMILES | Cc1cccc(OC(=O)c2c([O-])[n+](Cc3cncnc3)c3ccccn23)c1 |
| InChI | InChI=1S/C20H16N4O3/c1-14-5-4-6-16(9-14)27-20(26)18-19(25)24(12-15-10-21-13-22-11-15)17-7-2-3-8-23(17)18/h2-11,13H,12H2,1H3 |
| InChIKey | FGBANGHALGBPQW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|