C19H30N2O5Y-2 — CID 59623827
tert-butyl (2S,4R)-2-[(2-ethenyl-1-methoxycarbonylcyclopropyl)carbamoyl]-4-methanidylpyrrolidine-1-carboxylate;carbanide;yttrium (PubChem CID 59623827) has the molecular formula C19H30N2O5Y-2 and a molecular weight of 455.36 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(2-ethenyl-1-methoxycarbonylcyclopropyl)carbamoyl]-4-methanidylpyrrolidine-1-carboxylate;carbanide;yttrium.
| Compound Name | tert-butyl (2S,4R)-2-[(2-ethenyl-1-methoxycarbonylcyclopropyl)carbamoyl]-4-methanidylpyrrolidine-1-carboxylate;carbanide;yttrium |
|---|---|
| PubChem CID | 59623827 |
| Molecular Formula | C19H30N2O5Y-2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(2-ethenyl-1-methoxycarbonylcyclopropyl)carbamoyl]-4-methanidylpyrrolidine-1-carboxylate;carbanide;yttrium |
| SMILES | C=CC1CC1(NC(=O)[C@@H]1C[C@@H]([CH2-])CN1C(=O)OC(C)(C)C)C(=O)OC.[CH3-].[Y] |
| InChI | InChI=1S/C18H27N2O5.CH3.Y/c1-7-12-9-18(12,15(22)24-6)19-14(21)13-8-11(2)10-20(13)16(23)25-17(3,4)5;;/h7,11-13H,1-2,8-10H2,3-6H3,(H,19,21);1H3;/q2*-1;/t11-,12?,13+,18?;;/m1../s1 |
| InChIKey | OYMIEWXQXHUAMD-NSYDEKFCSA-N |
| XLogP | 2.13 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|