C30H33ClN8O2 — CID 59624460
6-[[4-[(3R)-3-amino-2-oxo-3-phenylpropyl]cyclohexyl]amino]-N-(2-chloro-4-pyridinyl)-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 59624460) has the molecular formula C30H33ClN8O2 and a molecular weight of 573.10 g/mol. Its IUPAC name is 6-[[4-[(3R)-3-amino-2-oxo-3-phenylpropyl]cyclohexyl]amino]-N-(2-chloro-4-pyridinyl)-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-[[4-[(3R)-3-amino-2-oxo-3-phenylpropyl]cyclohexyl]amino]-N-(2-chloro-4-pyridinyl)-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 59624460 |
| Molecular Formula | C30H33ClN8O2 |
| Molecular Weight | 573.10 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 6-[[4-[(3R)-3-amino-2-oxo-3-phenylpropyl]cyclohexyl]amino]-N-(2-chloro-4-pyridinyl)-8-(cyclopropylamino)imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | N[C@@H](C(=O)CC1CCC(Nc2cc(NC3CC3)c3ncc(C(=O)Nc4ccnc(Cl)c4)n3n2)CC1)c1ccccc1 |
| InChI | InChI=1S/C30H33ClN8O2/c31-26-15-22(12-13-33-26)37-30(41)24-17-34-29-23(35-20-10-11-20)16-27(38-39(24)29)36-21-8-6-18(7-9-21)14-25(40)28(32)19-4-2-1-3-5-19/h1-5,12-13,15-18,20-21,28,35H,6-11,14,32H2,(H,36,38)(H,33,37,41)/t18?,21?,28-/m1/s1 |
| InChIKey | CEACTSNMWHXPRL-VRODJZLMSA-N |
| XLogP | 5.23 |
| TPSA | 139.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.10 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|