C27H34ClN7O3 — CID 59624722
N-(2-chloro-4-pyridinyl)-8-(cyclopropylamino)-6-[[4-(5-methoxy-2-oxopentyl)cyclohexyl]amino]imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 59624722) has the molecular formula C27H34ClN7O3 and a molecular weight of 540.07 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-8-(cyclopropylamino)-6-[[4-(5-methoxy-2-oxopentyl)cyclohexyl]amino]imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-8-(cyclopropylamino)-6-[[4-(5-methoxy-2-oxopentyl)cyclohexyl]amino]imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 59624722 |
| Molecular Formula | C27H34ClN7O3 |
| Molecular Weight | 540.07 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-8-(cyclopropylamino)-6-[[4-(5-methoxy-2-oxopentyl)cyclohexyl]amino]imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | COCCCC(=O)CC1CCC(Nc2cc(NC3CC3)c3ncc(C(=O)Nc4ccnc(Cl)c4)n3n2)CC1 |
| InChI | InChI=1S/C27H34ClN7O3/c1-38-12-2-3-21(36)13-17-4-6-19(7-5-17)32-25-15-22(31-18-8-9-18)26-30-16-23(35(26)34-25)27(37)33-20-10-11-29-24(28)14-20/h10-11,14-19,31H,2-9,12-13H2,1H3,(H,32,34)(H,29,33,37) |
| InChIKey | CFBPUYQIHOZZIN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.07 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|