C10H12F3N3O3 — CID 59625335
4-(2-ethoxyethylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylic acid (PubChem CID 59625335) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is 4-(2-ethoxyethylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4-(2-ethoxyethylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 59625335 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-(2-ethoxyethylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylic acid |
| SMILES | CCOCCNc1nc(C(F)(F)F)ncc1C(=O)O |
| InChI | InChI=1S/C10H12F3N3O3/c1-2-19-4-3-14-7-6(8(17)18)5-15-9(16-7)10(11,12)13/h5H,2-4H2,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | PJQNBUOGXDMZFE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|