C22H32F3N3O3 — CID 59625513
tert-butyl 3-[[2-amino-4-(trifluoromethyl)benzoyl]-(2-methylpropyl)amino]piperidine-1-carboxylate (PubChem CID 59625513) has the molecular formula C22H32F3N3O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is tert-butyl 3-[[2-amino-4-(trifluoromethyl)benzoyl]-(2-methylpropyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-amino-4-(trifluoromethyl)benzoyl]-(2-methylpropyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59625513 |
| Molecular Formula | C22H32F3N3O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | tert-butyl 3-[[2-amino-4-(trifluoromethyl)benzoyl]-(2-methylpropyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)CN(C(=O)c1ccc(C(F)(F)F)cc1N)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H32F3N3O3/c1-14(2)12-28(16-7-6-10-27(13-16)20(30)31-21(3,4)5)19(29)17-9-8-15(11-18(17)26)22(23,24)25/h8-9,11,14,16H,6-7,10,12-13,26H2,1-5H3 |
| InChIKey | OUHUWMSPWAQFOE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|