C22H25N3O3 — CID 59626437
N-(1-amino-4-hydroxybutylidene)-9-(oxan-4-yl)carbazole-2-carboxamide (PubChem CID 59626437) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(1-amino-4-hydroxybutylidene)-9-(oxan-4-yl)carbazole-2-carboxamide.
| Compound Name | N-(1-amino-4-hydroxybutylidene)-9-(oxan-4-yl)carbazole-2-carboxamide |
|---|---|
| PubChem CID | 59626437 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-(1-amino-4-hydroxybutylidene)-9-(oxan-4-yl)carbazole-2-carboxamide |
| SMILES | N/C(CCCO)=N/C(=O)c1ccc2c3ccccc3n(C3CCOCC3)c2c1 |
| InChI | InChI=1S/C22H25N3O3/c23-21(6-3-11-26)24-22(27)15-7-8-18-17-4-1-2-5-19(17)25(20(18)14-15)16-9-12-28-13-10-16/h1-2,4-5,7-8,14,16,26H,3,6,9-13H2,(H2,23,24,27) |
| InChIKey | MDBOKLLVUXXCKP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|