C59H50N2 — CID 59630257
3-methyl-N-[4-[[4-(4-methyl-N-(3-methyl-4-phenylphenyl)anilino)phenyl]-phenylmethyl]phenyl]-N-(4-methylphenyl)-4-phenylaniline (PubChem CID 59630257) has the molecular formula C59H50N2 and a molecular weight of 787.06 g/mol. Its IUPAC name is 3-methyl-N-[4-[[4-(4-methyl-N-(3-methyl-4-phenylphenyl)anilino)phenyl]-phenylmethyl]phenyl]-N-(4-methylphenyl)-4-phenylaniline.
| Compound Name | 3-methyl-N-[4-[[4-(4-methyl-N-(3-methyl-4-phenylphenyl)anilino)phenyl]-phenylmethyl]phenyl]-N-(4-methylphenyl)-4-phenylaniline |
|---|---|
| PubChem CID | 59630257 |
| Molecular Formula | C59H50N2 |
| Molecular Weight | 787.06 g/mol |
| Exact Mass | 786.40 |
| IUPAC Name | 3-methyl-N-[4-[[4-(4-methyl-N-(3-methyl-4-phenylphenyl)anilino)phenyl]-phenylmethyl]phenyl]-N-(4-methylphenyl)-4-phenylaniline |
| SMILES | Cc1ccc(N(c2ccc(C(c3ccccc3)c3ccc(N(c4ccc(C)cc4)c4ccc(-c5ccccc5)c(C)c4)cc3)cc2)c2ccc(-c3ccccc3)c(C)c2)cc1 |
| InChI | InChI=1S/C59H50N2/c1-42-20-28-51(29-21-42)60(55-36-38-57(44(3)40-55)46-14-8-5-9-15-46)53-32-24-49(25-33-53)59(48-18-12-7-13-19-48)50-26-34-54(35-27-50)61(52-30-22-43(2)23-31-52)56-37-39-58(45(4)41-56)47-16-10-6-11-17-47/h5-41,59H,1-4H3 |
| InChIKey | RWUVUAVLLVJBQN-UHFFFAOYSA-N |
| XLogP | 16.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.06 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|