C21H47N5 — CID 59630651
N'-decyl-N'-[2-[2-(4-methylpiperazin-1-yl)ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 59630651) has the molecular formula C21H47N5 and a molecular weight of 369.64 g/mol. Its IUPAC name is N'-decyl-N'-[2-[2-(4-methylpiperazin-1-yl)ethylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-decyl-N'-[2-[2-(4-methylpiperazin-1-yl)ethylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 59630651 |
| Molecular Formula | C21H47N5 |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.38 |
| IUPAC Name | N'-decyl-N'-[2-[2-(4-methylpiperazin-1-yl)ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | CCCCCCCCCCN(CCN)CCNCCN1CCN(C)CC1 |
| InChI | InChI=1S/C21H47N5/c1-3-4-5-6-7-8-9-10-14-25(15-11-22)16-12-23-13-17-26-20-18-24(2)19-21-26/h23H,3-22H2,1-2H3 |
| InChIKey | FZSCCRMLJURUKM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|