C23H16ClF3N2O2S — CID 59633156
1-(2-chlorophenyl)-5-[3-(3-methylsulfonylphenyl)phenyl]-3-(trifluoromethyl)pyrazole (PubChem CID 59633156) has the molecular formula C23H16ClF3N2O2S and a molecular weight of 476.91 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-[3-(3-methylsulfonylphenyl)phenyl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-(2-chlorophenyl)-5-[3-(3-methylsulfonylphenyl)phenyl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 59633156 |
| Molecular Formula | C23H16ClF3N2O2S |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 1-(2-chlorophenyl)-5-[3-(3-methylsulfonylphenyl)phenyl]-3-(trifluoromethyl)pyrazole |
| SMILES | CS(=O)(=O)c1cccc(-c2cccc(-c3cc(C(F)(F)F)nn3-c3ccccc3Cl)c2)c1 |
| InChI | InChI=1S/C23H16ClF3N2O2S/c1-32(30,31)18-9-5-7-16(13-18)15-6-4-8-17(12-15)21-14-22(23(25,26)27)28-29(21)20-11-3-2-10-19(20)24/h2-14H,1H3 |
| InChIKey | VOOZJAGZCXOELE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |