C18H16FNO5S2 — CID 59634624
[8-fluoro-3-(2-methylsulfonylphenyl)quinolin-2-yl]methyl methanesulfonate (PubChem CID 59634624) has the molecular formula C18H16FNO5S2 and a molecular weight of 409.46 g/mol. Its IUPAC name is [8-fluoro-3-(2-methylsulfonylphenyl)quinolin-2-yl]methyl methanesulfonate.
| Compound Name | [8-fluoro-3-(2-methylsulfonylphenyl)quinolin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 59634624 |
| Molecular Formula | C18H16FNO5S2 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [8-fluoro-3-(2-methylsulfonylphenyl)quinolin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1nc2c(F)cccc2cc1-c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C18H16FNO5S2/c1-26(21,22)17-9-4-3-7-13(17)14-10-12-6-5-8-15(19)18(12)20-16(14)11-25-27(2,23)24/h3-10H,11H2,1-2H3 |
| InChIKey | KRIMPTFUIXIEFL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|