C29H20F3NO2S — CID 68939881
2-[3-(2-methylsulfonylphenyl)phenyl]-3-phenyl-8-(trifluoromethyl)quinoline (PubChem CID 68939881) has the molecular formula C29H20F3NO2S and a molecular weight of 503.55 g/mol. Its IUPAC name is 2-[3-(2-methylsulfonylphenyl)phenyl]-3-phenyl-8-(trifluoromethyl)quinoline.
| Compound Name | 2-[3-(2-methylsulfonylphenyl)phenyl]-3-phenyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 68939881 |
| Molecular Formula | C29H20F3NO2S |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 2-[3-(2-methylsulfonylphenyl)phenyl]-3-phenyl-8-(trifluoromethyl)quinoline |
| SMILES | CS(=O)(=O)c1ccccc1-c1cccc(-c2nc3c(C(F)(F)F)cccc3cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C29H20F3NO2S/c1-36(34,35)26-16-6-5-14-23(26)20-11-7-12-21(17-20)27-24(19-9-3-2-4-10-19)18-22-13-8-15-25(28(22)33-27)29(30,31)32/h2-18H,1H3 |
| InChIKey | OLWNFISVXJRGLH-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |