About [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate
[2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate (PubChem CID 59638258) has the molecular formula C14H24O4S2
and a molecular weight of 320.48 g/mol. Its IUPAC name is [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate.
Analyze [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate?
The IUPAC name of [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate (CID 59638258) is [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate.
What is the SMILES notation for [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate?
The canonical SMILES for [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OCC(=O)OC1CSCCCCS1.
What is the InChIKey of [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate?
The InChIKey is CFTSGVZHBDFIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4S2/c1-4-14(2,3)13(16)17-9-11(15)18-12-10-19-7-5-6-8-20-12/h12H,4-10H2,1-3H3.
What are the key properties of [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate?
[2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate has a molecular weight of 320.48 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,4-dithiocan-2-yloxy)-2-oxoethyl] 2,2-dimethylbutanoate is sourced from PubChem (CID 59638258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).