C26H38O2S — CID 59639072
2-(5-ethylsulfanyl-2-methylpentan-2-yl)-5-(2-methyl-5-phenylpentan-2-yl)benzene-1,4-diol (PubChem CID 59639072) has the molecular formula C26H38O2S and a molecular weight of 414.66 g/mol. Its IUPAC name is 2-(5-ethylsulfanyl-2-methylpentan-2-yl)-5-(2-methyl-5-phenylpentan-2-yl)benzene-1,4-diol.
| Compound Name | 2-(5-ethylsulfanyl-2-methylpentan-2-yl)-5-(2-methyl-5-phenylpentan-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 59639072 |
| Molecular Formula | C26H38O2S |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 2-(5-ethylsulfanyl-2-methylpentan-2-yl)-5-(2-methyl-5-phenylpentan-2-yl)benzene-1,4-diol |
| SMILES | CCSCCCC(C)(C)c1cc(O)c(C(C)(C)CCCc2ccccc2)cc1O |
| InChI | InChI=1S/C26H38O2S/c1-6-29-17-11-16-26(4,5)22-19-23(27)21(18-24(22)28)25(2,3)15-10-14-20-12-8-7-9-13-20/h7-9,12-13,18-19,27-28H,6,10-11,14-17H2,1-5H3 |
| InChIKey | PVLMKUICZUFOPN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|