C17H26N4O4 — CID 59639327
N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 59639327) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 59639327 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[(2S)-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](C)NC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H26N4O4/c1-13(20-17(23)21-9-11-25-12-10-21)16(22)19-8-7-18-14-3-5-15(24-2)6-4-14/h3-6,13,18H,7-12H2,1-2H3,(H,19,22)(H,20,23)/t13-/m0/s1 |
| InChIKey | BRRGAVRVIHBICG-ZDUSSCGKSA-N |
| XLogP | 0.65 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|